C8H16N4O2 — CID 105359678
2-[2-[3-(1-aminoethyl)-1,2,4-triazol-1-yl]ethoxy]ethanol (PubChem CID 105359678) has the molecular formula C8H16N4O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is 2-[2-[3-(1-aminoethyl)-1,2,4-triazol-1-yl]ethoxy]ethanol.
| Compound Name | 2-[2-[3-(1-aminoethyl)-1,2,4-triazol-1-yl]ethoxy]ethanol |
|---|---|
| PubChem CID | 105359678 |
| Molecular Formula | C8H16N4O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2-[2-[3-(1-aminoethyl)-1,2,4-triazol-1-yl]ethoxy]ethanol |
| SMILES | CC(N)c1ncn(CCOCCO)n1 |
| InChI | InChI=1S/C8H16N4O2/c1-7(9)8-10-6-12(11-8)2-4-14-5-3-13/h6-7,13H,2-5,9H2,1H3 |
| InChIKey | CZHJNDVSCJWLQR-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|