C17H8Br2ClN3 — CID 132588492
5,6-bis(3-bromophenyl)-3-chloropyrazine-2-carbonitrile (PubChem CID 132588492) has the molecular formula C17H8Br2ClN3 and a molecular weight of 449.53 g/mol. Its IUPAC name is 5,6-bis(3-bromophenyl)-3-chloropyrazine-2-carbonitrile.
| Compound Name | 5,6-bis(3-bromophenyl)-3-chloropyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 132588492 |
| Molecular Formula | C17H8Br2ClN3 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 446.88 |
| IUPAC Name | 5,6-bis(3-bromophenyl)-3-chloropyrazine-2-carbonitrile |
| SMILES | N#Cc1nc(-c2cccc(Br)c2)c(-c2cccc(Br)c2)nc1Cl |
| InChI | InChI=1S/C17H8Br2ClN3/c18-12-5-1-3-10(7-12)15-16(11-4-2-6-13(19)8-11)23-17(20)14(9-21)22-15/h1-8H |
| InChIKey | YIUIUBFJIPBKEG-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |