C19H18BrF2NO2 — CID 132589392
benzyl 6-bromo-2-ethyl-5,8-difluoro-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 132589392) has the molecular formula C19H18BrF2NO2 and a molecular weight of 410.26 g/mol. Its IUPAC name is benzyl 6-bromo-2-ethyl-5,8-difluoro-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | benzyl 6-bromo-2-ethyl-5,8-difluoro-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 132589392 |
| Molecular Formula | C19H18BrF2NO2 |
| Molecular Weight | 410.26 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | benzyl 6-bromo-2-ethyl-5,8-difluoro-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CCC1CCc2c(F)c(Br)cc(F)c2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H18BrF2NO2/c1-2-13-8-9-14-17(22)15(20)10-16(21)18(14)23(13)19(24)25-11-12-6-4-3-5-7-12/h3-7,10,13H,2,8-9,11H2,1H3 |
| InChIKey | PWKPVLBATWVUSD-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.26 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|