C23H17BrClF2NO2 — CID 132590126
benzyl 8-bromo-2-(3-chlorophenyl)-6,7-difluoro-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 132590126) has the molecular formula C23H17BrClF2NO2 and a molecular weight of 492.75 g/mol. Its IUPAC name is benzyl 8-bromo-2-(3-chlorophenyl)-6,7-difluoro-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | benzyl 8-bromo-2-(3-chlorophenyl)-6,7-difluoro-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 132590126 |
| Molecular Formula | C23H17BrClF2NO2 |
| Molecular Weight | 492.75 g/mol |
| Exact Mass | 491.01 |
| IUPAC Name | benzyl 8-bromo-2-(3-chlorophenyl)-6,7-difluoro-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1c2c(cc(F)c(F)c2Br)CCC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H17BrClF2NO2/c24-20-21(27)18(26)12-16-9-10-19(15-7-4-8-17(25)11-15)28(22(16)20)23(29)30-13-14-5-2-1-3-6-14/h1-8,11-12,19H,9-10,13H2 |
| InChIKey | YYWKQPSTCGOZOJ-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.75 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|