C20H19BrClF2NO2 — CID 132590125
tert-butyl 8-bromo-2-(3-chlorophenyl)-6,7-difluoro-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 132590125) has the molecular formula C20H19BrClF2NO2 and a molecular weight of 458.73 g/mol. Its IUPAC name is tert-butyl 8-bromo-2-(3-chlorophenyl)-6,7-difluoro-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | tert-butyl 8-bromo-2-(3-chlorophenyl)-6,7-difluoro-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 132590125 |
| Molecular Formula | C20H19BrClF2NO2 |
| Molecular Weight | 458.73 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | tert-butyl 8-bromo-2-(3-chlorophenyl)-6,7-difluoro-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1c2c(cc(F)c(F)c2Br)CCC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H19BrClF2NO2/c1-20(2,3)27-19(26)25-15(11-5-4-6-13(22)9-11)8-7-12-10-14(23)17(24)16(21)18(12)25/h4-6,9-10,15H,7-8H2,1-3H3 |
| InChIKey | SHJDOJGUIPBJNR-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.73 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|