C21H22BrF2NO3 — CID 132589855
tert-butyl 8-bromo-5,6-difluoro-2-(4-methoxyphenyl)-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 132589855) has the molecular formula C21H22BrF2NO3 and a molecular weight of 454.31 g/mol. Its IUPAC name is tert-butyl 8-bromo-5,6-difluoro-2-(4-methoxyphenyl)-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | tert-butyl 8-bromo-5,6-difluoro-2-(4-methoxyphenyl)-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 132589855 |
| Molecular Formula | C21H22BrF2NO3 |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | tert-butyl 8-bromo-5,6-difluoro-2-(4-methoxyphenyl)-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | COc1ccc(C2CCc3c(F)c(F)cc(Br)c3N2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H22BrF2NO3/c1-21(2,3)28-20(26)25-17(12-5-7-13(27-4)8-6-12)10-9-14-18(24)16(23)11-15(22)19(14)25/h5-8,11,17H,9-10H2,1-4H3 |
| InChIKey | GHQRTSATTJAKHC-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|