C15H18BrF2NO2 — CID 132589276
tert-butyl 6-bromo-5,8-difluoro-2-methyl-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 132589276) has the molecular formula C15H18BrF2NO2 and a molecular weight of 362.21 g/mol. Its IUPAC name is tert-butyl 6-bromo-5,8-difluoro-2-methyl-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | tert-butyl 6-bromo-5,8-difluoro-2-methyl-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 132589276 |
| Molecular Formula | C15H18BrF2NO2 |
| Molecular Weight | 362.21 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | tert-butyl 6-bromo-5,8-difluoro-2-methyl-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CC1CCc2c(F)c(Br)cc(F)c2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H18BrF2NO2/c1-8-5-6-9-12(18)10(16)7-11(17)13(9)19(8)14(20)21-15(2,3)4/h7-8H,5-6H2,1-4H3 |
| InChIKey | DOSLGODDMDHTQL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.21 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|