C17H20BrF2NO2 — CID 132589462
tert-butyl 8-bromo-2-cyclopropyl-6,7-difluoro-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 132589462) has the molecular formula C17H20BrF2NO2 and a molecular weight of 388.25 g/mol. Its IUPAC name is tert-butyl 8-bromo-2-cyclopropyl-6,7-difluoro-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | tert-butyl 8-bromo-2-cyclopropyl-6,7-difluoro-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 132589462 |
| Molecular Formula | C17H20BrF2NO2 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | tert-butyl 8-bromo-2-cyclopropyl-6,7-difluoro-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1c2c(cc(F)c(F)c2Br)CCC1C1CC1 |
| InChI | InChI=1S/C17H20BrF2NO2/c1-17(2,3)23-16(22)21-12(9-4-5-9)7-6-10-8-11(19)14(20)13(18)15(10)21/h8-9,12H,4-7H2,1-3H3 |
| InChIKey | IKJOXCLJWROVFG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|