C23H18BrFN2O4 — CID 132590024
benzyl 8-bromo-2-(3-fluorophenyl)-6-nitro-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 132590024) has the molecular formula C23H18BrFN2O4 and a molecular weight of 485.31 g/mol. Its IUPAC name is benzyl 8-bromo-2-(3-fluorophenyl)-6-nitro-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | benzyl 8-bromo-2-(3-fluorophenyl)-6-nitro-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 132590024 |
| Molecular Formula | C23H18BrFN2O4 |
| Molecular Weight | 485.31 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | benzyl 8-bromo-2-(3-fluorophenyl)-6-nitro-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1c2c(Br)cc([N+](=O)[O-])cc2CCC1c1cccc(F)c1 |
| InChI | InChI=1S/C23H18BrFN2O4/c24-20-13-19(27(29)30)12-17-9-10-21(16-7-4-8-18(25)11-16)26(22(17)20)23(28)31-14-15-5-2-1-3-6-15/h1-8,11-13,21H,9-10,14H2 |
| InChIKey | KIVFTFPDXIOMQZ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.31 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|