C21H23BrN2O4 — CID 132589601
benzyl 8-bromo-2-tert-butyl-6-nitro-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 132589601) has the molecular formula C21H23BrN2O4 and a molecular weight of 447.33 g/mol. Its IUPAC name is benzyl 8-bromo-2-tert-butyl-6-nitro-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | benzyl 8-bromo-2-tert-butyl-6-nitro-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 132589601 |
| Molecular Formula | C21H23BrN2O4 |
| Molecular Weight | 447.33 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | benzyl 8-bromo-2-tert-butyl-6-nitro-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CC(C)(C)C1CCc2cc([N+](=O)[O-])cc(Br)c2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H23BrN2O4/c1-21(2,3)18-10-9-15-11-16(24(26)27)12-17(22)19(15)23(18)20(25)28-13-14-7-5-4-6-8-14/h4-8,11-12,18H,9-10,13H2,1-3H3 |
| InChIKey | ACPUCEBYDRSMSS-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.33 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|