C22H25BrN2O4 — CID 132589627
tert-butyl 8-bromo-6-nitro-2-(2-phenylethyl)-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 132589627) has the molecular formula C22H25BrN2O4 and a molecular weight of 461.36 g/mol. Its IUPAC name is tert-butyl 8-bromo-6-nitro-2-(2-phenylethyl)-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | tert-butyl 8-bromo-6-nitro-2-(2-phenylethyl)-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 132589627 |
| Molecular Formula | C22H25BrN2O4 |
| Molecular Weight | 461.36 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | tert-butyl 8-bromo-6-nitro-2-(2-phenylethyl)-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1c2c(Br)cc([N+](=O)[O-])cc2CCC1CCc1ccccc1 |
| InChI | InChI=1S/C22H25BrN2O4/c1-22(2,3)29-21(26)24-17(11-9-15-7-5-4-6-8-15)12-10-16-13-18(25(27)28)14-19(23)20(16)24/h4-8,13-14,17H,9-12H2,1-3H3 |
| InChIKey | QDLKPUHGKUDXJC-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.36 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|