C19H20INO2S — CID 132592985
2-[3-ethoxy-5-iodo-4-[(3-methylphenyl)methoxy]phenyl]-4,5-dihydro-1,3-thiazole (PubChem CID 132592985) has the molecular formula C19H20INO2S and a molecular weight of 453.35 g/mol. Its IUPAC name is 2-[3-ethoxy-5-iodo-4-[(3-methylphenyl)methoxy]phenyl]-4,5-dihydro-1,3-thiazole.
| Compound Name | 2-[3-ethoxy-5-iodo-4-[(3-methylphenyl)methoxy]phenyl]-4,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 132592985 |
| Molecular Formula | C19H20INO2S |
| Molecular Weight | 453.35 g/mol |
| Exact Mass | 453.03 |
| IUPAC Name | 2-[3-ethoxy-5-iodo-4-[(3-methylphenyl)methoxy]phenyl]-4,5-dihydro-1,3-thiazole |
| SMILES | CCOc1cc(C2=NCCS2)cc(I)c1OCc1cccc(C)c1 |
| InChI | InChI=1S/C19H20INO2S/c1-3-22-17-11-15(19-21-7-8-24-19)10-16(20)18(17)23-12-14-6-4-5-13(2)9-14/h4-6,9-11H,3,7-8,12H2,1-2H3 |
| InChIKey | NLJXUWFDDGWJKI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.35 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|