C16H13I2NOS — CID 132593082
2-(3,5-diiodo-4-phenylmethoxyphenyl)-4,5-dihydro-1,3-thiazole (PubChem CID 132593082) has the molecular formula C16H13I2NOS and a molecular weight of 521.16 g/mol. Its IUPAC name is 2-(3,5-diiodo-4-phenylmethoxyphenyl)-4,5-dihydro-1,3-thiazole.
| Compound Name | 2-(3,5-diiodo-4-phenylmethoxyphenyl)-4,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 132593082 |
| Molecular Formula | C16H13I2NOS |
| Molecular Weight | 521.16 g/mol |
| Exact Mass | 520.88 |
| IUPAC Name | 2-(3,5-diiodo-4-phenylmethoxyphenyl)-4,5-dihydro-1,3-thiazole |
| SMILES | Ic1cc(C2=NCCS2)cc(I)c1OCc1ccccc1 |
| InChI | InChI=1S/C16H13I2NOS/c17-13-8-12(16-19-6-7-21-16)9-14(18)15(13)20-10-11-4-2-1-3-5-11/h1-5,8-9H,6-7,10H2 |
| InChIKey | FHYBPJIIWTYKFX-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.16 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|