C16H11Cl2I2NOS — CID 132593092
2-[4-[(3,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]-4,5-dihydro-1,3-thiazole (PubChem CID 132593092) has the molecular formula C16H11Cl2I2NOS and a molecular weight of 590.05 g/mol. Its IUPAC name is 2-[4-[(3,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]-4,5-dihydro-1,3-thiazole.
| Compound Name | 2-[4-[(3,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]-4,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 132593092 |
| Molecular Formula | C16H11Cl2I2NOS |
| Molecular Weight | 590.05 g/mol |
| Exact Mass | 588.80 |
| IUPAC Name | 2-[4-[(3,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]-4,5-dihydro-1,3-thiazole |
| SMILES | Clc1ccc(COc2c(I)cc(C3=NCCS3)cc2I)cc1Cl |
| InChI | InChI=1S/C16H11Cl2I2NOS/c17-11-2-1-9(5-12(11)18)8-22-15-13(19)6-10(7-14(15)20)16-21-3-4-23-16/h1-2,5-7H,3-4,8H2 |
| InChIKey | MYEDLMAOVYZXCU-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.05 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|