C22H22N2O6S — CID 132595347
methyl (3aR,9bS)-2,9b-dimethyl-1-(2-nitrophenyl)sulfonyl-4,5-dihydro-3aH-benzo[g]indole-3-carboxylate (PubChem CID 132595347) has the molecular formula C22H22N2O6S and a molecular weight of 442.49 g/mol. Its IUPAC name is methyl (3aR,9bS)-2,9b-dimethyl-1-(2-nitrophenyl)sulfonyl-4,5-dihydro-3aH-benzo[g]indole-3-carboxylate.
| Compound Name | methyl (3aR,9bS)-2,9b-dimethyl-1-(2-nitrophenyl)sulfonyl-4,5-dihydro-3aH-benzo[g]indole-3-carboxylate |
|---|---|
| PubChem CID | 132595347 |
| Molecular Formula | C22H22N2O6S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | methyl (3aR,9bS)-2,9b-dimethyl-1-(2-nitrophenyl)sulfonyl-4,5-dihydro-3aH-benzo[g]indole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(S(=O)(=O)c2ccccc2[N+](=O)[O-])[C@]2(C)c3ccccc3CC[C@H]12 |
| InChI | InChI=1S/C22H22N2O6S/c1-14-20(21(25)30-3)17-13-12-15-8-4-5-9-16(15)22(17,2)23(14)31(28,29)19-11-7-6-10-18(19)24(26)27/h4-11,17H,12-13H2,1-3H3/t17-,22-/m1/s1 |
| InChIKey | HHCHIAQVOVBTDL-VGOFRKELSA-N |
| XLogP | 3.52 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|