C20H24N4O7S — CID 34233740
methyl 2-ethyl-4-methyl-5-[4-(2-nitrophenyl)sulfonylpiperazine-1-carbonyl]-1H-pyrrole-3-carboxylate (PubChem CID 34233740) has the molecular formula C20H24N4O7S and a molecular weight of 464.50 g/mol. Its IUPAC name is methyl 2-ethyl-4-methyl-5-[4-(2-nitrophenyl)sulfonylpiperazine-1-carbonyl]-1H-pyrrole-3-carboxylate.
| Compound Name | methyl 2-ethyl-4-methyl-5-[4-(2-nitrophenyl)sulfonylpiperazine-1-carbonyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 34233740 |
| Molecular Formula | C20H24N4O7S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | methyl 2-ethyl-4-methyl-5-[4-(2-nitrophenyl)sulfonylpiperazine-1-carbonyl]-1H-pyrrole-3-carboxylate |
| SMILES | CCc1[nH]c(C(=O)N2CCN(S(=O)(=O)c3ccccc3[N+](=O)[O-])CC2)c(C)c1C(=O)OC |
| InChI | InChI=1S/C20H24N4O7S/c1-4-14-17(20(26)31-3)13(2)18(21-14)19(25)22-9-11-23(12-10-22)32(29,30)16-8-6-5-7-15(16)24(27)28/h5-8,21H,4,9-12H2,1-3H3 |
| InChIKey | OORTUAPUACKCPC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 142.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|