C31H29N5O3 — CID 132598320
1-[9-oxo-5-[[(1S)-1-phenylethyl]carbamoylamino]-10H-acridin-4-yl]-3-[(1S)-1-phenylethyl]urea (PubChem CID 132598320) has the molecular formula C31H29N5O3 and a molecular weight of 519.61 g/mol. Its IUPAC name is 1-[9-oxo-5-[[(1S)-1-phenylethyl]carbamoylamino]-10H-acridin-4-yl]-3-[(1S)-1-phenylethyl]urea.
| Compound Name | 1-[9-oxo-5-[[(1S)-1-phenylethyl]carbamoylamino]-10H-acridin-4-yl]-3-[(1S)-1-phenylethyl]urea |
|---|---|
| PubChem CID | 132598320 |
| Molecular Formula | C31H29N5O3 |
| Molecular Weight | 519.61 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | 1-[9-oxo-5-[[(1S)-1-phenylethyl]carbamoylamino]-10H-acridin-4-yl]-3-[(1S)-1-phenylethyl]urea |
| SMILES | C[C@H](NC(=O)Nc1cccc2c(=O)c3cccc(NC(=O)N[C@@H](C)c4ccccc4)c3[nH]c12)c1ccccc1 |
| InChI | InChI=1S/C31H29N5O3/c1-19(21-11-5-3-6-12-21)32-30(38)34-25-17-9-15-23-27(25)36-28-24(29(23)37)16-10-18-26(28)35-31(39)33-20(2)22-13-7-4-8-14-22/h3-20H,1-2H3,(H,36,37)(H2,32,34,38)(H2,33,35,39)/t19-,20-/m0/s1 |
| InChIKey | RRIUFVZNBRORTL-PMACEKPBSA-N |
| XLogP | 6.45 |
| TPSA | 115.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.61 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|