C24H17NO2 — CID 132598652
1-(4-methoxyphenyl)-2-phenylindeno[1,2-c]pyrrol-4-one (PubChem CID 132598652) has the molecular formula C24H17NO2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-phenylindeno[1,2-c]pyrrol-4-one.
| Compound Name | 1-(4-methoxyphenyl)-2-phenylindeno[1,2-c]pyrrol-4-one |
|---|---|
| PubChem CID | 132598652 |
| Molecular Formula | C24H17NO2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-phenylindeno[1,2-c]pyrrol-4-one |
| SMILES | COc1ccc(-c2c3c(cn2-c2ccccc2)C(=O)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C24H17NO2/c1-27-18-13-11-16(12-14-18)23-22-19-9-5-6-10-20(19)24(26)21(22)15-25(23)17-7-3-2-4-8-17/h2-15H,1H3 |
| InChIKey | KWLIWDMMRLDYMT-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |