C29H27N6O2PS — CID 132599341
2-azido-1-(2,3-dihydropyrrolo[2,3-b]pyridin-1-yl)-3-(diphenylphosphinothioylamino)-3-(3-methoxyphenyl)propan-1-one (PubChem CID 132599341) has the molecular formula C29H27N6O2PS and a molecular weight of 554.62 g/mol. Its IUPAC name is 2-azido-1-(2,3-dihydropyrrolo[2,3-b]pyridin-1-yl)-3-(diphenylphosphinothioylamino)-3-(3-methoxyphenyl)propan-1-one.
| Compound Name | 2-azido-1-(2,3-dihydropyrrolo[2,3-b]pyridin-1-yl)-3-(diphenylphosphinothioylamino)-3-(3-methoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 132599341 |
| Molecular Formula | C29H27N6O2PS |
| Molecular Weight | 554.62 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | 2-azido-1-(2,3-dihydropyrrolo[2,3-b]pyridin-1-yl)-3-(diphenylphosphinothioylamino)-3-(3-methoxyphenyl)propan-1-one |
| SMILES | COc1cccc(C(NP(=S)(c2ccccc2)c2ccccc2)C(N=[N+]=[N-])C(=O)N2CCc3cccnc32)c1 |
| InChI | InChI=1S/C29H27N6O2PS/c1-37-23-12-8-10-22(20-23)26(27(32-34-30)29(36)35-19-17-21-11-9-18-31-28(21)35)33-38(39,24-13-4-2-5-14-24)25-15-6-3-7-16-25/h2-16,18,20,26-27H,17,19H2,1H3,(H,33,39) |
| InChIKey | AKFVLHPSXLRUHY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 103.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.62 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|