C21H23N3O4S — CID 132600669
N-[(7R,8aR)-5-oxo-7-(2-phenylethyl)-1,7,8,8a-tetrahydroimidazo[1,5-c][1,3]oxazin-3-yl]-4-methylbenzenesulfonamide (PubChem CID 132600669) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is N-[(7R,8aR)-5-oxo-7-(2-phenylethyl)-1,7,8,8a-tetrahydroimidazo[1,5-c][1,3]oxazin-3-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(7R,8aR)-5-oxo-7-(2-phenylethyl)-1,7,8,8a-tetrahydroimidazo[1,5-c][1,3]oxazin-3-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 132600669 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | N-[(7R,8aR)-5-oxo-7-(2-phenylethyl)-1,7,8,8a-tetrahydroimidazo[1,5-c][1,3]oxazin-3-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2=NC[C@H]3C[C@@H](CCc4ccccc4)OC(=O)N23)cc1 |
| InChI | InChI=1S/C21H23N3O4S/c1-15-7-11-19(12-8-15)29(26,27)23-20-22-14-17-13-18(28-21(25)24(17)20)10-9-16-5-3-2-4-6-16/h2-8,11-12,17-18H,9-10,13-14H2,1H3,(H,22,23)/t17-,18-/m1/s1 |
| InChIKey | BRKLQMXYMFUWJK-QZTJIDSGSA-N |
| XLogP | 2.86 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |