C31H30N2O4 — CID 132601274
(2S,3aR,8bR)-3-(9H-fluoren-9-ylmethoxycarbonyl)-8b-(3-methylbut-2-enyl)-1,2,3a,4-tetrahydropyrrolo[2,3-b]indole-2-carboxylic acid (PubChem CID 132601274) has the molecular formula C31H30N2O4 and a molecular weight of 494.59 g/mol. Its IUPAC name is (2S,3aR,8bR)-3-(9H-fluoren-9-ylmethoxycarbonyl)-8b-(3-methylbut-2-enyl)-1,2,3a,4-tetrahydropyrrolo[2,3-b]indole-2-carboxylic acid.
| Compound Name | (2S,3aR,8bR)-3-(9H-fluoren-9-ylmethoxycarbonyl)-8b-(3-methylbut-2-enyl)-1,2,3a,4-tetrahydropyrrolo[2,3-b]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 132601274 |
| Molecular Formula | C31H30N2O4 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | (2S,3aR,8bR)-3-(9H-fluoren-9-ylmethoxycarbonyl)-8b-(3-methylbut-2-enyl)-1,2,3a,4-tetrahydropyrrolo[2,3-b]indole-2-carboxylic acid |
| SMILES | CC(C)=CC[C@]12C[C@@H](C(=O)O)N(C(=O)OCC3c4ccccc4-c4ccccc43)[C@H]1Nc1ccccc12 |
| InChI | InChI=1S/C31H30N2O4/c1-19(2)15-16-31-17-27(28(34)35)33(29(31)32-26-14-8-7-13-25(26)31)30(36)37-18-24-22-11-5-3-9-20(22)21-10-4-6-12-23(21)24/h3-15,24,27,29,32H,16-18H2,1-2H3,(H,34,35)/t27-,29+,31+/m0/s1 |
| InChIKey | LYFDHZKFIQCSHG-GKFGNYHGSA-N |
| XLogP | 6.14 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|