C15H20O3 — CID 132602922
(1S,4S,9R,13S)-5,5,9-trimethyl-3-oxatricyclo[5.5.1.04,13]tridec-6-ene-2,8-dione (PubChem CID 132602922) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (1S,4S,9R,13S)-5,5,9-trimethyl-3-oxatricyclo[5.5.1.04,13]tridec-6-ene-2,8-dione.
| Compound Name | (1S,4S,9R,13S)-5,5,9-trimethyl-3-oxatricyclo[5.5.1.04,13]tridec-6-ene-2,8-dione |
|---|---|
| PubChem CID | 132602922 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (1S,4S,9R,13S)-5,5,9-trimethyl-3-oxatricyclo[5.5.1.04,13]tridec-6-ene-2,8-dione |
| SMILES | C[C@@H]1CCC[C@@H]2C(=O)O[C@H]3[C@@H]2C(=CC3(C)C)C1=O |
| InChI | InChI=1S/C15H20O3/c1-8-5-4-6-9-11-10(12(8)16)7-15(2,3)13(11)18-14(9)17/h7-9,11,13H,4-6H2,1-3H3/t8-,9+,11+,13+/m1/s1 |
| InChIKey | SEIUFLHUPFOWPB-KOVQTIFSSA-N |
| XLogP | 2.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |