C9H16F2O3 — CID 132603402
(2S,4S)-2-tert-butyl-3,3-difluorooxane-2,4-diol (PubChem CID 132603402) has the molecular formula C9H16F2O3 and a molecular weight of 210.22 g/mol. Its IUPAC name is (2S,4S)-2-tert-butyl-3,3-difluorooxane-2,4-diol.
| Compound Name | (2S,4S)-2-tert-butyl-3,3-difluorooxane-2,4-diol |
|---|---|
| PubChem CID | 132603402 |
| Molecular Formula | C9H16F2O3 |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | (2S,4S)-2-tert-butyl-3,3-difluorooxane-2,4-diol |
| SMILES | CC(C)(C)[C@]1(O)OCC[C@H](O)C1(F)F |
| InChI | InChI=1S/C9H16F2O3/c1-7(2,3)9(13)8(10,11)6(12)4-5-14-9/h6,12-13H,4-5H2,1-3H3/t6-,9-/m0/s1 |
| InChIKey | XIOQKAKLGXQATJ-RCOVLWMOSA-N |
| XLogP | 1.14 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |