C20H23O4PS — CID 132604993
1-[bis[2-(furan-2-yl)ethyl]phosphoryl]-2-phenylsulfanylethanol (PubChem CID 132604993) has the molecular formula C20H23O4PS and a molecular weight of 390.44 g/mol. Its IUPAC name is 1-[bis[2-(furan-2-yl)ethyl]phosphoryl]-2-phenylsulfanylethanol.
| Compound Name | 1-[bis[2-(furan-2-yl)ethyl]phosphoryl]-2-phenylsulfanylethanol |
|---|---|
| PubChem CID | 132604993 |
| Molecular Formula | C20H23O4PS |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 1-[bis[2-(furan-2-yl)ethyl]phosphoryl]-2-phenylsulfanylethanol |
| SMILES | O=P(CCc1ccco1)(CCc1ccco1)C(O)CSc1ccccc1 |
| InChI | InChI=1S/C20H23O4PS/c21-20(16-26-19-8-2-1-3-9-19)25(22,14-10-17-6-4-12-23-17)15-11-18-7-5-13-24-18/h1-9,12-13,20-21H,10-11,14-16H2 |
| InChIKey | PFQKWBVSLPAIKW-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|