C20H23O2PS2 — CID 122223842
bis[2-(furan-2-yl)ethyl]-(2-phenylsulfanylethyl)-sulfanylidene-λ5-phosphane (PubChem CID 122223842) has the molecular formula C20H23O2PS2 and a molecular weight of 390.51 g/mol. Its IUPAC name is bis[2-(furan-2-yl)ethyl]-(2-phenylsulfanylethyl)-sulfanylidene-λ5-phosphane.
| Compound Name | bis[2-(furan-2-yl)ethyl]-(2-phenylsulfanylethyl)-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 122223842 |
| Molecular Formula | C20H23O2PS2 |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | bis[2-(furan-2-yl)ethyl]-(2-phenylsulfanylethyl)-sulfanylidene-λ5-phosphane |
| SMILES | S=P(CCSc1ccccc1)(CCc1ccco1)CCc1ccco1 |
| InChI | InChI=1S/C20H23O2PS2/c24-23(14-10-18-6-4-12-21-18,15-11-19-7-5-13-22-19)16-17-25-20-8-2-1-3-9-20/h1-9,12-13H,10-11,14-17H2 |
| InChIKey | DSSRZPGMHFJZTB-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|