C17H16N2OSe — CID 132606237
2-(2,4,6-trimethylphenyl)selanylimidazo[1,2-a]pyridine-3-carbaldehyde (PubChem CID 132606237) has the molecular formula C17H16N2OSe and a molecular weight of 343.29 g/mol. Its IUPAC name is 2-(2,4,6-trimethylphenyl)selanylimidazo[1,2-a]pyridine-3-carbaldehyde.
| Compound Name | 2-(2,4,6-trimethylphenyl)selanylimidazo[1,2-a]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 132606237 |
| Molecular Formula | C17H16N2OSe |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 2-(2,4,6-trimethylphenyl)selanylimidazo[1,2-a]pyridine-3-carbaldehyde |
| SMILES | Cc1cc(C)c([Se]c2nc3ccccn3c2C=O)c(C)c1 |
| InChI | InChI=1S/C17H16N2OSe/c1-11-8-12(2)16(13(3)9-11)21-17-14(10-20)19-7-5-4-6-15(19)18-17/h4-10H,1-3H3 |
| InChIKey | BJEVXZQNGIRNTR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|