C14H7Cl3N2O2 — CID 43477950
2-(2,4,5-trichlorophenoxy)imidazo[1,2-a]pyridine-3-carbaldehyde (PubChem CID 43477950) has the molecular formula C14H7Cl3N2O2 and a molecular weight of 341.58 g/mol. Its IUPAC name is 2-(2,4,5-trichlorophenoxy)imidazo[1,2-a]pyridine-3-carbaldehyde.
| Compound Name | 2-(2,4,5-trichlorophenoxy)imidazo[1,2-a]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 43477950 |
| Molecular Formula | C14H7Cl3N2O2 |
| Molecular Weight | 341.58 g/mol |
| Exact Mass | 339.96 |
| IUPAC Name | 2-(2,4,5-trichlorophenoxy)imidazo[1,2-a]pyridine-3-carbaldehyde |
| SMILES | O=Cc1c(Oc2cc(Cl)c(Cl)cc2Cl)nc2ccccn12 |
| InChI | InChI=1S/C14H7Cl3N2O2/c15-8-5-10(17)12(6-9(8)16)21-14-11(7-20)19-4-2-1-3-13(19)18-14/h1-7H |
| InChIKey | ABGDSPITBQGXCT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|