C16H14N2O2 — CID 43477988
2-(4-ethylphenoxy)imidazo[1,2-a]pyridine-3-carbaldehyde (PubChem CID 43477988) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-(4-ethylphenoxy)imidazo[1,2-a]pyridine-3-carbaldehyde.
| Compound Name | 2-(4-ethylphenoxy)imidazo[1,2-a]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 43477988 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 2-(4-ethylphenoxy)imidazo[1,2-a]pyridine-3-carbaldehyde |
| SMILES | CCc1ccc(Oc2nc3ccccn3c2C=O)cc1 |
| InChI | InChI=1S/C16H14N2O2/c1-2-12-6-8-13(9-7-12)20-16-14(11-19)18-10-4-3-5-15(18)17-16/h3-11H,2H2,1H3 |
| InChIKey | PMEDEJRNZPFVBD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|