C14H10Cl2N2O2 — CID 43478483
[2-(2,5-dichlorophenoxy)imidazo[1,2-a]pyridin-3-yl]methanol (PubChem CID 43478483) has the molecular formula C14H10Cl2N2O2 and a molecular weight of 309.15 g/mol. Its IUPAC name is [2-(2,5-dichlorophenoxy)imidazo[1,2-a]pyridin-3-yl]methanol.
| Compound Name | [2-(2,5-dichlorophenoxy)imidazo[1,2-a]pyridin-3-yl]methanol |
|---|---|
| PubChem CID | 43478483 |
| Molecular Formula | C14H10Cl2N2O2 |
| Molecular Weight | 309.15 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | [2-(2,5-dichlorophenoxy)imidazo[1,2-a]pyridin-3-yl]methanol |
| SMILES | OCc1c(Oc2cc(Cl)ccc2Cl)nc2ccccn12 |
| InChI | InChI=1S/C14H10Cl2N2O2/c15-9-4-5-10(16)12(7-9)20-14-11(8-19)18-6-2-1-3-13(18)17-14/h1-7,19H,8H2 |
| InChIKey | ZBPXMAIBTXUQSO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.15 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |