C9H12BrN3OS — CID 13260652
1-amino-3-[(3-bromo-4-methoxyphenyl)methyl]thiourea (PubChem CID 13260652) has the molecular formula C9H12BrN3OS and a molecular weight of 290.19 g/mol. Its IUPAC name is 1-amino-3-[(3-bromo-4-methoxyphenyl)methyl]thiourea.
| Compound Name | 1-amino-3-[(3-bromo-4-methoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 13260652 |
| Molecular Formula | C9H12BrN3OS |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 1-amino-3-[(3-bromo-4-methoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CNC(=S)NN)cc1Br |
| InChI | InChI=1S/C9H12BrN3OS/c1-14-8-3-2-6(4-7(8)10)5-12-9(15)13-11/h2-4H,5,11H2,1H3,(H2,12,13,15) |
| InChIKey | PYFXOLSTFROLGO-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|