C26H21OP — CID 132607145
(5S)-6-methyl-5-(2-methylphenyl)-2-phenylbenzo[b]phosphindole 5-oxide (PubChem CID 132607145) has the molecular formula C26H21OP and a molecular weight of 380.43 g/mol. Its IUPAC name is (5S)-6-methyl-5-(2-methylphenyl)-2-phenylbenzo[b]phosphindole 5-oxide.
| Compound Name | (5S)-6-methyl-5-(2-methylphenyl)-2-phenylbenzo[b]phosphindole 5-oxide |
|---|---|
| PubChem CID | 132607145 |
| Molecular Formula | C26H21OP |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (5S)-6-methyl-5-(2-methylphenyl)-2-phenylbenzo[b]phosphindole 5-oxide |
| SMILES | Cc1ccccc1[P@]1(=O)c2ccc(-c3ccccc3)cc2-c2cccc(C)c21 |
| InChI | InChI=1S/C26H21OP/c1-18-9-6-7-14-24(18)28(27)25-16-15-21(20-11-4-3-5-12-20)17-23(25)22-13-8-10-19(2)26(22)28/h3-17H,1-2H3/t28-/m0/s1 |
| InChIKey | PUNHZFHIJMXKLT-NDEPHWFRSA-N |
| XLogP | 5.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|