C16H30N4O3S2 — CID 132608572
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-5-(2-sulfanylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (PubChem CID 132608572) has the molecular formula C16H30N4O3S2 and a molecular weight of 390.58 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-5-(2-sulfanylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-5-(2-sulfanylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
|---|---|
| PubChem CID | 132608572 |
| Molecular Formula | C16H30N4O3S2 |
| Molecular Weight | 390.58 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-5-(2-sulfanylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| SMILES | NCCOCCOCCNC(=O)CCCCC1SCC2NC(=S)NC21 |
| InChI | InChI=1S/C16H30N4O3S2/c17-5-7-22-9-10-23-8-6-18-14(21)4-2-1-3-13-15-12(11-25-13)19-16(24)20-15/h12-13,15H,1-11,17H2,(H,18,21)(H2,19,20,24) |
| InChIKey | FIYGSQCJANFGAB-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.58 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|