C20H17NO4 — CID 132608814
methyl (3aS,8bS)-8b-hydroxy-2-(4-methylphenyl)-4-oxo-3H-indeno[1,2-b]pyrrole-3a-carboxylate (PubChem CID 132608814) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is methyl (3aS,8bS)-8b-hydroxy-2-(4-methylphenyl)-4-oxo-3H-indeno[1,2-b]pyrrole-3a-carboxylate.
| Compound Name | methyl (3aS,8bS)-8b-hydroxy-2-(4-methylphenyl)-4-oxo-3H-indeno[1,2-b]pyrrole-3a-carboxylate |
|---|---|
| PubChem CID | 132608814 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | methyl (3aS,8bS)-8b-hydroxy-2-(4-methylphenyl)-4-oxo-3H-indeno[1,2-b]pyrrole-3a-carboxylate |
| SMILES | COC(=O)[C@@]12CC(c3ccc(C)cc3)=N[C@]1(O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H17NO4/c1-12-7-9-13(10-8-12)16-11-19(18(23)25-2)17(22)14-5-3-4-6-15(14)20(19,24)21-16/h3-10,24H,11H2,1-2H3/t19-,20-/m0/s1 |
| InChIKey | WBOSYHXIKOTWKM-PMACEKPBSA-N |
| XLogP | 2.39 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|