C26H20N2O5 — CID 44607058
methyl (5R)-5-[(R)-(1,3-dioxoisoindol-2-yl)-phenylmethyl]-3-phenyl-4H-1,2-oxazole-5-carboxylate (PubChem CID 44607058) has the molecular formula C26H20N2O5 and a molecular weight of 440.46 g/mol. Its IUPAC name is methyl (5R)-5-[(R)-(1,3-dioxoisoindol-2-yl)-phenylmethyl]-3-phenyl-4H-1,2-oxazole-5-carboxylate.
| Compound Name | methyl (5R)-5-[(R)-(1,3-dioxoisoindol-2-yl)-phenylmethyl]-3-phenyl-4H-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 44607058 |
| Molecular Formula | C26H20N2O5 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | methyl (5R)-5-[(R)-(1,3-dioxoisoindol-2-yl)-phenylmethyl]-3-phenyl-4H-1,2-oxazole-5-carboxylate |
| SMILES | COC(=O)[C@]1([C@@H](c2ccccc2)N2C(=O)c3ccccc3C2=O)CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C26H20N2O5/c1-32-25(31)26(16-21(27-33-26)17-10-4-2-5-11-17)22(18-12-6-3-7-13-18)28-23(29)19-14-8-9-15-20(19)24(28)30/h2-15,22H,16H2,1H3/t22-,26-/m1/s1 |
| InChIKey | DMHOCODYATZUKS-ATIYNZHBSA-N |
| XLogP | 3.76 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|