C22H32O5 — CID 132609381
[(1'R,2R,3R,3aS,5R,5'S,5aS,9aR,9bS)-3,6,6,9a-tetramethyl-3'-oxospiro[1,3,3a,4,5,5a,7,8,9,9b-decahydrocyclopenta[a]naphthalene-2,4'-2,6-dioxabicyclo[3.1.0]hexane]-5-yl] acetate (PubChem CID 132609381) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is [(1'R,2R,3R,3aS,5R,5'S,5aS,9aR,9bS)-3,6,6,9a-tetramethyl-3'-oxospiro[1,3,3a,4,5,5a,7,8,9,9b-decahydrocyclopenta[a]naphthalene-2,4'-2,6-dioxabicyclo[3.1.0]hexane]-5-yl] acetate.
| Compound Name | [(1'R,2R,3R,3aS,5R,5'S,5aS,9aR,9bS)-3,6,6,9a-tetramethyl-3'-oxospiro[1,3,3a,4,5,5a,7,8,9,9b-decahydrocyclopenta[a]naphthalene-2,4'-2,6-dioxabicyclo[3.1.0]hexane]-5-yl] acetate |
|---|---|
| PubChem CID | 132609381 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | [(1'R,2R,3R,3aS,5R,5'S,5aS,9aR,9bS)-3,6,6,9a-tetramethyl-3'-oxospiro[1,3,3a,4,5,5a,7,8,9,9b-decahydrocyclopenta[a]naphthalene-2,4'-2,6-dioxabicyclo[3.1.0]hexane]-5-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H]2[C@@H](C)[C@@]3(C[C@@H]2[C@@]2(C)CCCC(C)(C)[C@H]12)C(=O)O[C@H]1O[C@H]13 |
| InChI | InChI=1S/C22H32O5/c1-11-13-9-15(25-12(2)23)16-20(3,4)7-6-8-21(16,5)14(13)10-22(11)17-18(26-17)27-19(22)24/h11,13-18H,6-10H2,1-5H3/t11-,13+,14+,15-,16+,17-,18-,21-,22-/m1/s1 |
| InChIKey | PSVVSOSQNNLIOT-QULBUKAKSA-N |
| XLogP | 3.69 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|