C25H24ClFN2O2 — CID 132611663
2-[(2-chlorophenyl)methyl-[2-(4-fluorophenyl)acetyl]amino]-N-methyl-3-phenylpropanamide (PubChem CID 132611663) has the molecular formula C25H24ClFN2O2 and a molecular weight of 438.93 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-[2-(4-fluorophenyl)acetyl]amino]-N-methyl-3-phenylpropanamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-[2-(4-fluorophenyl)acetyl]amino]-N-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 132611663 |
| Molecular Formula | C25H24ClFN2O2 |
| Molecular Weight | 438.93 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-[2-(4-fluorophenyl)acetyl]amino]-N-methyl-3-phenylpropanamide |
| SMILES | CNC(=O)C(Cc1ccccc1)N(Cc1ccccc1Cl)C(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C25H24ClFN2O2/c1-28-25(31)23(15-18-7-3-2-4-8-18)29(17-20-9-5-6-10-22(20)26)24(30)16-19-11-13-21(27)14-12-19/h2-14,23H,15-17H2,1H3,(H,28,31) |
| InChIKey | JTPUHSWHYFLXFW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.93 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |