C21H25BrN2O4 — CID 132612705
2-[(3-bromophenyl)methyl-[2-(2-methoxyphenoxy)acetyl]amino]-N-ethylpropanamide (PubChem CID 132612705) has the molecular formula C21H25BrN2O4 and a molecular weight of 449.35 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl-[2-(2-methoxyphenoxy)acetyl]amino]-N-ethylpropanamide.
| Compound Name | 2-[(3-bromophenyl)methyl-[2-(2-methoxyphenoxy)acetyl]amino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 132612705 |
| Molecular Formula | C21H25BrN2O4 |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 2-[(3-bromophenyl)methyl-[2-(2-methoxyphenoxy)acetyl]amino]-N-ethylpropanamide |
| SMILES | CCNC(=O)C(C)N(Cc1cccc(Br)c1)C(=O)COc1ccccc1OC |
| InChI | InChI=1S/C21H25BrN2O4/c1-4-23-21(26)15(2)24(13-16-8-7-9-17(22)12-16)20(25)14-28-19-11-6-5-10-18(19)27-3/h5-12,15H,4,13-14H2,1-3H3,(H,23,26) |
| InChIKey | CQZZLMSVMFRCSY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |