C25H27BrN2O3 — CID 132617171
2-[(3-bromophenyl)methyl-(2-naphthalen-1-yloxyacetyl)amino]-N-propylpropanamide (PubChem CID 132617171) has the molecular formula C25H27BrN2O3 and a molecular weight of 483.41 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl-(2-naphthalen-1-yloxyacetyl)amino]-N-propylpropanamide.
| Compound Name | 2-[(3-bromophenyl)methyl-(2-naphthalen-1-yloxyacetyl)amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 132617171 |
| Molecular Formula | C25H27BrN2O3 |
| Molecular Weight | 483.41 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 2-[(3-bromophenyl)methyl-(2-naphthalen-1-yloxyacetyl)amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)N(Cc1cccc(Br)c1)C(=O)COc1cccc2ccccc12 |
| InChI | InChI=1S/C25H27BrN2O3/c1-3-14-27-25(30)18(2)28(16-19-8-6-11-21(26)15-19)24(29)17-31-23-13-7-10-20-9-4-5-12-22(20)23/h4-13,15,18H,3,14,16-17H2,1-2H3,(H,27,30) |
| InChIKey | KCTVPEOGGLACAD-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.41 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |