C26H30N2O4 — CID 100521307
(2S)-2-[(3-methoxyphenyl)methyl-(2-naphthalen-1-yloxyacetyl)amino]-N-propylpropanamide (PubChem CID 100521307) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is (2S)-2-[(3-methoxyphenyl)methyl-(2-naphthalen-1-yloxyacetyl)amino]-N-propylpropanamide.
| Compound Name | (2S)-2-[(3-methoxyphenyl)methyl-(2-naphthalen-1-yloxyacetyl)amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 100521307 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | (2S)-2-[(3-methoxyphenyl)methyl-(2-naphthalen-1-yloxyacetyl)amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)[C@H](C)N(Cc1cccc(OC)c1)C(=O)COc1cccc2ccccc12 |
| InChI | InChI=1S/C26H30N2O4/c1-4-15-27-26(30)19(2)28(17-20-9-7-12-22(16-20)31-3)25(29)18-32-24-14-8-11-21-10-5-6-13-23(21)24/h5-14,16,19H,4,15,17-18H2,1-3H3,(H,27,30)/t19-/m0/s1 |
| InChIKey | BLBKVZZAZYGBFP-IBGZPJMESA-N |
| XLogP | 4.17 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |