C26H30N2O4 — CID 132670146
N-ethyl-2-[(3-methoxyphenyl)methyl-(2-naphthalen-1-yloxyacetyl)amino]butanamide (PubChem CID 132670146) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-ethyl-2-[(3-methoxyphenyl)methyl-(2-naphthalen-1-yloxyacetyl)amino]butanamide.
| Compound Name | N-ethyl-2-[(3-methoxyphenyl)methyl-(2-naphthalen-1-yloxyacetyl)amino]butanamide |
|---|---|
| PubChem CID | 132670146 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | N-ethyl-2-[(3-methoxyphenyl)methyl-(2-naphthalen-1-yloxyacetyl)amino]butanamide |
| SMILES | CCNC(=O)C(CC)N(Cc1cccc(OC)c1)C(=O)COc1cccc2ccccc12 |
| InChI | InChI=1S/C26H30N2O4/c1-4-23(26(30)27-5-2)28(17-19-10-8-13-21(16-19)31-3)25(29)18-32-24-15-9-12-20-11-6-7-14-22(20)24/h6-16,23H,4-5,17-18H2,1-3H3,(H,27,30) |
| InChIKey | RHVJRRLNNRCUEB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |