C28H34N2O4 — CID 132720248
N-butan-2-yl-2-[(4-methoxyphenyl)methyl-(2-naphthalen-1-yloxyacetyl)amino]butanamide (PubChem CID 132720248) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is N-butan-2-yl-2-[(4-methoxyphenyl)methyl-(2-naphthalen-1-yloxyacetyl)amino]butanamide.
| Compound Name | N-butan-2-yl-2-[(4-methoxyphenyl)methyl-(2-naphthalen-1-yloxyacetyl)amino]butanamide |
|---|---|
| PubChem CID | 132720248 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | N-butan-2-yl-2-[(4-methoxyphenyl)methyl-(2-naphthalen-1-yloxyacetyl)amino]butanamide |
| SMILES | CCC(C)NC(=O)C(CC)N(Cc1ccc(OC)cc1)C(=O)COc1cccc2ccccc12 |
| InChI | InChI=1S/C28H34N2O4/c1-5-20(3)29-28(32)25(6-2)30(18-21-14-16-23(33-4)17-15-21)27(31)19-34-26-13-9-11-22-10-7-8-12-24(22)26/h7-17,20,25H,5-6,18-19H2,1-4H3,(H,29,32) |
| InChIKey | GZGWCQAXNUMJFO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |