C27H31ClN2O3 — CID 132721563
N-butan-2-yl-2-[(2-chlorophenyl)methyl-(2-naphthalen-1-yloxyacetyl)amino]butanamide (PubChem CID 132721563) has the molecular formula C27H31ClN2O3 and a molecular weight of 467.01 g/mol. Its IUPAC name is N-butan-2-yl-2-[(2-chlorophenyl)methyl-(2-naphthalen-1-yloxyacetyl)amino]butanamide.
| Compound Name | N-butan-2-yl-2-[(2-chlorophenyl)methyl-(2-naphthalen-1-yloxyacetyl)amino]butanamide |
|---|---|
| PubChem CID | 132721563 |
| Molecular Formula | C27H31ClN2O3 |
| Molecular Weight | 467.01 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | N-butan-2-yl-2-[(2-chlorophenyl)methyl-(2-naphthalen-1-yloxyacetyl)amino]butanamide |
| SMILES | CCC(C)NC(=O)C(CC)N(Cc1ccccc1Cl)C(=O)COc1cccc2ccccc12 |
| InChI | InChI=1S/C27H31ClN2O3/c1-4-19(3)29-27(32)24(5-2)30(17-21-12-7-9-15-23(21)28)26(31)18-33-25-16-10-13-20-11-6-8-14-22(20)25/h6-16,19,24H,4-5,17-18H2,1-3H3,(H,29,32) |
| InChIKey | KLBXHOQFAODSDB-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.01 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |