C20H32N2O3 — CID 132700582
2-[butanoyl-[(4-methoxyphenyl)methyl]amino]-N-butan-2-ylbutanamide (PubChem CID 132700582) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is 2-[butanoyl-[(4-methoxyphenyl)methyl]amino]-N-butan-2-ylbutanamide.
| Compound Name | 2-[butanoyl-[(4-methoxyphenyl)methyl]amino]-N-butan-2-ylbutanamide |
|---|---|
| PubChem CID | 132700582 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | 2-[butanoyl-[(4-methoxyphenyl)methyl]amino]-N-butan-2-ylbutanamide |
| SMILES | CCCC(=O)N(Cc1ccc(OC)cc1)C(CC)C(=O)NC(C)CC |
| InChI | InChI=1S/C20H32N2O3/c1-6-9-19(23)22(14-16-10-12-17(25-5)13-11-16)18(8-3)20(24)21-15(4)7-2/h10-13,15,18H,6-9,14H2,1-5H3,(H,21,24) |
| InChIKey | IASLVMKHRMPTDO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |