C26H30N2O3 — CID 100732305
(2R)-2-[benzyl-(2-naphthalen-1-yloxyacetyl)amino]-N-propan-2-ylbutanamide (PubChem CID 100732305) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is (2R)-2-[benzyl-(2-naphthalen-1-yloxyacetyl)amino]-N-propan-2-ylbutanamide.
| Compound Name | (2R)-2-[benzyl-(2-naphthalen-1-yloxyacetyl)amino]-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 100732305 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | (2R)-2-[benzyl-(2-naphthalen-1-yloxyacetyl)amino]-N-propan-2-ylbutanamide |
| SMILES | CC[C@H](C(=O)NC(C)C)N(Cc1ccccc1)C(=O)COc1cccc2ccccc12 |
| InChI | InChI=1S/C26H30N2O3/c1-4-23(26(30)27-19(2)3)28(17-20-11-6-5-7-12-20)25(29)18-31-24-16-10-14-21-13-8-9-15-22(21)24/h5-16,19,23H,4,17-18H2,1-3H3,(H,27,30)/t23-/m1/s1 |
| InChIKey | VNCPEQOCJKKRQR-HSZRJFAPSA-N |
| XLogP | 4.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |