C22H28N2O5 — CID 132661195
2-[[2-(2-methoxyphenoxy)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-methylbutanamide (PubChem CID 132661195) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-[[2-(2-methoxyphenoxy)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-methylbutanamide.
| Compound Name | 2-[[2-(2-methoxyphenoxy)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-methylbutanamide |
|---|---|
| PubChem CID | 132661195 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 2-[[2-(2-methoxyphenoxy)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-methylbutanamide |
| SMILES | CCC(C(=O)NC)N(Cc1cccc(OC)c1)C(=O)COc1ccccc1OC |
| InChI | InChI=1S/C22H28N2O5/c1-5-18(22(26)23-2)24(14-16-9-8-10-17(13-16)27-3)21(25)15-29-20-12-7-6-11-19(20)28-4/h6-13,18H,5,14-15H2,1-4H3,(H,23,26) |
| InChIKey | RODOBHKFEISINL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |