C25H30Cl2N2O2 — CID 132614260
N-cyclohexyl-2-[[2-(2,6-dichlorophenyl)acetyl]-(2-phenylethyl)amino]propanamide (PubChem CID 132614260) has the molecular formula C25H30Cl2N2O2 and a molecular weight of 461.43 g/mol. Its IUPAC name is N-cyclohexyl-2-[[2-(2,6-dichlorophenyl)acetyl]-(2-phenylethyl)amino]propanamide.
| Compound Name | N-cyclohexyl-2-[[2-(2,6-dichlorophenyl)acetyl]-(2-phenylethyl)amino]propanamide |
|---|---|
| PubChem CID | 132614260 |
| Molecular Formula | C25H30Cl2N2O2 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | N-cyclohexyl-2-[[2-(2,6-dichlorophenyl)acetyl]-(2-phenylethyl)amino]propanamide |
| SMILES | CC(C(=O)NC1CCCCC1)N(CCc1ccccc1)C(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C25H30Cl2N2O2/c1-18(25(31)28-20-11-6-3-7-12-20)29(16-15-19-9-4-2-5-10-19)24(30)17-21-22(26)13-8-14-23(21)27/h2,4-5,8-10,13-14,18,20H,3,6-7,11-12,15-17H2,1H3,(H,28,31) |
| InChIKey | ISMHECZSJCCSOD-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |