C27H36N2O2 — CID 132947782
N-cyclohexyl-2-[[2-(3,4-dimethylphenyl)acetyl]-(2-phenylethyl)amino]propanamide (PubChem CID 132947782) has the molecular formula C27H36N2O2 and a molecular weight of 420.60 g/mol. Its IUPAC name is N-cyclohexyl-2-[[2-(3,4-dimethylphenyl)acetyl]-(2-phenylethyl)amino]propanamide.
| Compound Name | N-cyclohexyl-2-[[2-(3,4-dimethylphenyl)acetyl]-(2-phenylethyl)amino]propanamide |
|---|---|
| PubChem CID | 132947782 |
| Molecular Formula | C27H36N2O2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | N-cyclohexyl-2-[[2-(3,4-dimethylphenyl)acetyl]-(2-phenylethyl)amino]propanamide |
| SMILES | Cc1ccc(CC(=O)N(CCc2ccccc2)C(C)C(=O)NC2CCCCC2)cc1C |
| InChI | InChI=1S/C27H36N2O2/c1-20-14-15-24(18-21(20)2)19-26(30)29(17-16-23-10-6-4-7-11-23)22(3)27(31)28-25-12-8-5-9-13-25/h4,6-7,10-11,14-15,18,22,25H,5,8-9,12-13,16-17,19H2,1-3H3,(H,28,31) |
| InChIKey | HBWDIZTUUVJBJZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |