C27H30N2O5 — CID 132614341
2-[benzyl-[2-(3,5-dimethoxyphenoxy)acetyl]amino]-N-methyl-3-phenylpropanamide (PubChem CID 132614341) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is 2-[benzyl-[2-(3,5-dimethoxyphenoxy)acetyl]amino]-N-methyl-3-phenylpropanamide.
| Compound Name | 2-[benzyl-[2-(3,5-dimethoxyphenoxy)acetyl]amino]-N-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 132614341 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 2-[benzyl-[2-(3,5-dimethoxyphenoxy)acetyl]amino]-N-methyl-3-phenylpropanamide |
| SMILES | CNC(=O)C(Cc1ccccc1)N(Cc1ccccc1)C(=O)COc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C27H30N2O5/c1-28-27(31)25(14-20-10-6-4-7-11-20)29(18-21-12-8-5-9-13-21)26(30)19-34-24-16-22(32-2)15-23(17-24)33-3/h4-13,15-17,25H,14,18-19H2,1-3H3,(H,28,31) |
| InChIKey | SFFOIDMYTCIUOG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |