C32H38N2O5 — CID 133175814
2-[benzyl-[2-(3,5-dimethoxyphenoxy)acetyl]amino]-N-cyclohexyl-3-phenylpropanamide (PubChem CID 133175814) has the molecular formula C32H38N2O5 and a molecular weight of 530.67 g/mol. Its IUPAC name is 2-[benzyl-[2-(3,5-dimethoxyphenoxy)acetyl]amino]-N-cyclohexyl-3-phenylpropanamide.
| Compound Name | 2-[benzyl-[2-(3,5-dimethoxyphenoxy)acetyl]amino]-N-cyclohexyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133175814 |
| Molecular Formula | C32H38N2O5 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | 2-[benzyl-[2-(3,5-dimethoxyphenoxy)acetyl]amino]-N-cyclohexyl-3-phenylpropanamide |
| SMILES | COc1cc(OC)cc(OCC(=O)N(Cc2ccccc2)C(Cc2ccccc2)C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C32H38N2O5/c1-37-27-19-28(38-2)21-29(20-27)39-23-31(35)34(22-25-14-8-4-9-15-25)30(18-24-12-6-3-7-13-24)32(36)33-26-16-10-5-11-17-26/h3-4,6-9,12-15,19-21,26,30H,5,10-11,16-18,22-23H2,1-2H3,(H,33,36) |
| InChIKey | VIBGKWRYMLMMOD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |