C25H24ClN3O4 — CID 132614856
2-[(4-chlorophenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]-N-methyl-3-phenylpropanamide (PubChem CID 132614856) has the molecular formula C25H24ClN3O4 and a molecular weight of 465.94 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]-N-methyl-3-phenylpropanamide.
| Compound Name | 2-[(4-chlorophenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]-N-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 132614856 |
| Molecular Formula | C25H24ClN3O4 |
| Molecular Weight | 465.94 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl-[2-(2-nitrophenyl)acetyl]amino]-N-methyl-3-phenylpropanamide |
| SMILES | CNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)cc1)C(=O)Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H24ClN3O4/c1-27-25(31)23(15-18-7-3-2-4-8-18)28(17-19-11-13-21(26)14-12-19)24(30)16-20-9-5-6-10-22(20)29(32)33/h2-14,23H,15-17H2,1H3,(H,27,31) |
| InChIKey | NULUQMCYDAFWGM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.94 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|